FLIAECNI0001
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIA Isoflavone : FLIAEC 6-Hydroxyorobol and O-methyl derivatives (21 pages) : FLIAECNI Non-cyclic prenyl substituted (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 130286-71-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIAECNI0001.mol |
| Pre-5-methoxydurmillone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 7-Hydroxy-5,6-dimethoxy-3',4'-methylenedioxy-8-prenylisoflavone |
| Common Name |
|
| Symbol | |
| Formula | C23H22O7 |
| Exact Mass | 410.136553058 |
| Average Mass | 410.41658000000007 |
| SMILES | c(c(CC=C(C)C)4)(c3c(c(c4O)OC)OC)OC=C(C(=O)3)c(c2)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
