FLIC1LNP0009
From Metabolomics.JP
				
								
				
				
																
				
				
								
				
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input | 
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIC Isoflavan : FLIC1L 7,2',(3'),4',(5'),(6')-Hydroxyisoflavan and O-methyl derivatives (34 pages) : FLIC1LNP Pyranoflavonoid (11 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 68978-02-9 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FLIC1LNP0009.mol | 
| Hispaglabridin B | |
|---|---|
  
 | |
| Structural Information | |
| Systematic Name | 2,2-Dimethyl-6- [ [ (R) -3,4-dihydro-8,8-dimethyl-2H,8H-benzo [ 1,2-b:3,4-b' ] dipyran ] -3beta-yl ] -2H-1-benzopyran-5-ol | 
| Common Name | 
  | 
| Symbol | |
| Formula | C25H26O4 | 
| Exact Mass | 390.18310931999997 | 
| Average Mass | 390.47153999999995 | 
| SMILES |  c(c(O)1)(C(C3)COc(c54)c3ccc4OC(C)(C)C=C5)ccc(O2)c1 | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
  | 
