FLIC1LNP0011
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIC Isoflavan : FLIC1L 7,2',(3'),4',(5'),(6')-Hydroxyisoflavan and O-methyl derivatives (34 pages) : FLIC1LNP Pyranoflavonoid (11 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 66446-91-1 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIC1LNP0011.mol |
| Nitidulan | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 6- [ 3,4-Dihydro-8-methyl-8- (4-methyl-3-pentenyl) -2H,8H-benzo [ 1,2-b:3,4-b' ] dipyran-3-yl ] -1,3-benzodioxol-5-ol |
| Common Name |
|
| Symbol | |
| Formula | C26H28O5 |
| Exact Mass | 420.193674006 |
| Average Mass | 420.49752 |
| SMILES | Oc(c2)c(C(C5)Cc(c4O5)ccc(c43)OC(C)(CCC=C(C)C)C=C3) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
