FLIC1LNS0009
From Metabolomics.JP
				
								
				
				
																
				
				
								
				
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input | 
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIC Isoflavan : FLIC1L 7,2',(3'),4',(5'),(6')-Hydroxyisoflavan and O-methyl derivatives (34 pages) : FLIC1LNS Simple substitution (14 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 72026-91-6 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FLIC1LNS0009.mol | 
| Astraciceran | |
|---|---|
  
 | |
| Structural Information | |
| Systematic Name | 7-Hydroxy-2'-methoxy-4',5'-methylenedioxyisoflavan | 
| Common Name | 
  | 
| Symbol | |
| Formula | C17H16O5 | 
| Exact Mass | 300.099773622 | 
| Average Mass | 300.30593999999996 | 
| SMILES | COc(c3)c(cc(O4)c(OC4)3)C(C1)Cc(c2)c(cc(O)c2)O1 | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
  | 
