FLIC4LNS0002
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIC Isoflavan : FLIC4L 6,7,8,2',(3'),4',(5'),(6')-Hydroxyisoflavan and O-methyl derivatives (1 pages) : FLIC4LNS Simple substitution (1 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 51798-42-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIC4LNS0002.mol |
| Machaerol B | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 6,2'-Dihydroxy-7,8,3',4'-tetramethoxyisoflavan |
| Common Name |
|
| Symbol | |
| Formula | C19H22O7 |
| Exact Mass | 362.136553058 |
| Average Mass | 362.37378 |
| SMILES | c(c3OC)(O)cc(c(c3OC)1)CC(c(c2O)ccc(c2OC)OC)CO1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
