FLID1ANP0003
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLID Pterocarpane : FLID1A Demethylmedicarpin and O-methyl derivatives (26 pages) : FLID1ANP Pyranoflavonoid (7 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 66446-92-2 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLID1ANP0003.mol |
| Hemileiocarpin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (6aS,11aS) -6a,11a-Dihydro-9-methoxy-2,2-dimethyl-2H,6H-benzofuro [ 3,2-c ] pyrano [ 2,3-h ] [ 1 ] benzopyran |
| Common Name |
|
| Symbol | |
| Formula | C21H20O4 |
| Exact Mass | 336.136159128 |
| Average Mass | 336.38109999999995 |
| SMILES | C(C52)(COc(c54)c(c(cc4)3)C=CC(C)(C)O3)c(c1)c(O2)cc |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
