FLID3ANS0001
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLID Pterocarpane : FLID3A 3,4,9-Trihydroxypterocarpane and O-methyl derivatives (5 pages) : FLID3ANS Simple substitution (5 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 61135-95-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLID3ANS0001.mol |
| 4-Hydroxyhomopterocarpin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | [ 6aR,11aR, (-) ] -6a,11a-Dihydro-3,9-dimethoxy-6H-benzofuro [ 3,2-c ] [ 1 ] benzopyran-4-ol |
| Common Name |
|
| Symbol | |
| Formula | C17H16O5 |
| Exact Mass | 300.099773622 |
| Average Mass | 300.30593999999996 |
| SMILES | COc(c4)cc(O1)c(c4)C([H])(C3)C([H])1c(c2)c(O3)c(O)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
