FLIE1ANP0001
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIE Coumestan : FLIE1A Coumestrol and O-methyl derivtives (15 pages) : FLIE1ANP Pyranoflavonoid (5 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 18979-00-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIE1ANP0001.mol |
| Sojagol | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2,3-Dihydro-10-hydroxy-3,3-dimethyl-1H,7H-furo [ 3,2-c:5,4-f' ] bis [ 1 ] benzopyran-7-one |
| Common Name |
|
| Symbol | |
| Formula | C20H16O5 |
| Exact Mass | 336.099773622 |
| Average Mass | 336.33804000000003 |
| SMILES | c(O)(c5)ccc(c51)c(o4)c(c(c42)ccc(O3)c2CCC(C)(C)3)C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
