FLNA29NS0002
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLN Neoflavonoid : FLNA 4-Arylcoumarin : FLNA29 6,7,(3'),(5')-Trihydroxy-4-phenylcoumarin and O-methyl derivatives (4 pages) : FLNA29NS Simple substitution (4 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 1857-05-2 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLNA29NS0002.mol |
| Methyldalbergin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 6,7-Dimethoxy-4-phenylcoumarin |
| Common Name |
|
| Symbol | |
| Formula | C17H14O4 |
| Exact Mass | 282.089208936 |
| Average Mass | 282.29066 |
| SMILES | COc(c3)c(OC)cc(c23)C(=CC(=O)O2)c(c1)cccc1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
