FLNC29NS0002
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLN Neoflavonoid : FLNC Dalbergiquinol : FLNC29 2,4,5,(3'),(5')-Hydroxydalbergiquinol and O-methyl derivatives (3 pages) : FLNC29NS Simple substitution (3 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 3527-07-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLNC29NS0002.mol |
| Obtusaquinol | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (R,S) -2,5-Dihydroxy-4-methoxydalbergiquinol |
| Common Name |
|
| Symbol | |
| Formula | C16H16O3 |
| Exact Mass | 256.109944378 |
| Average Mass | 256.29643999999996 |
| SMILES | COc(c2)c(O)cc(c(O)2)C(C=C)c(c1)cccc1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
