FLIAALNS0005
From Metabolomics.JP
(Redirected from INCHI:BVMYGPIULRZQPJ-UHFFFAOYSA-N)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIA Isoflavone : FLIAAL 5,7,2',(3'),4',(5'),(6')-Hydroxyisoflavone and O-methyl derivatives (59 pages) : FLIAALNS Simple substitution (8 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 73428-16-7 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIAALNS0005.mol |
| Derrugenin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,4'-Dihydroxy-7,2',5'-trimethoxyisoflavone |
| Common Name |
|
| Symbol | |
| Formula | C18H16O7 |
| Exact Mass | 344.089602866 |
| Average Mass | 344.31543999999997 |
| SMILES | c(c13)(O)cc(OC)cc1OC=C(C3=O)c(c(OC)2)cc(OC)c(O)c2 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
