FL1CHYNP0010
From Metabolomics.JP
(Redirected from INCHI:KLIBVTLWIJEYNK-AQTBWJFISA-N)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1C Chalcone : FL1CHY beta-Hydroxychalcone (36 pages) : FL1CHYNP Pyranoflavonoid (9 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | - |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1CHYNP0010.mol |
| 7-Methoxypraecansone B | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 6",6"-Dimethylpyrano [ 2",3":4',3' ] -2',6',beta-trimethoxychalcone |
| Common Name |
|
| Symbol | |
| Formula | C23H24O5 |
| Exact Mass | 380.162373878 |
| Average Mass | 380.43366000000003 |
| SMILES | c(c31)(C=CC(O3)(C)C)c(OC)c(C(C=C(OC)c(c2)cccc2)=O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
