FL4DALNI0005
From Metabolomics.JP
(Redirected from INCHI:QKEDJCCCNZWOBS-LMFRUQSNSA-N)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL4 Dihydroflavonol : FL4DAL 5,7,2',(3'),4',(5'),(6')-Hydroxydihydroflavonol and O-methyl derivatives (15 pages) : FL4DALNI Non-cyclic prenyl substituted (11 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 102490-65-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL4DALNI0005.mol |
| Kushenol N | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (2R) -2',3alpha,4',7-Tetrahydroxy-5-methoxy-8- [ (R) -2- (1-methylethenyl) -5-methyl-4-hexenyl ] flavanone |
| Common Name |
|
| Symbol | |
| Formula | C26H30O7 |
| Exact Mass | 454.199153314 |
| Average Mass | 454.5122 |
| SMILES | COc(c1)c(C(=O)2)c(OC(c(c3)c(cc(O)c3)O)C(O)2)c(c1O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
