LBF14000HO03
From Metabolomics.JP
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA0347 |
| LipidMaps | LMFA01050081 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF14000HO03.mol |
| 3,11-dihydroxymyristoic acid/ipurolic acid | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,11-Dihydroxytetradecanoic acid |
| Common Name |
|
| Symbol | |
| Formula | C14H28O4 |
| Exact Mass | 260.19875938399997 |
| Average Mass | 260.36972 |
| SMILES | CCCC(O)CCCCCCCC(O)CC(O)=O |
| Physicochemical Information | |
| Melting Point | 100-101°C |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | soluble in chloroform and ethanol<<0262>><<0342>><<0371>><<0403>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
