LBF14000HO03
From Metabolomics.JP
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA0347 |
LipidMaps | LMFA01050081 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF14000HO03.mol |
3,11-dihydroxymyristoic acid/ipurolic acid | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 3,11-Dihydroxytetradecanoic acid |
Common Name |
|
Symbol | |
Formula | C14H28O4 |
Exact Mass | 260.19875938399997 |
Average Mass | 260.36972 |
SMILES | CCCC(O)CCCCCCCC(O)CC(O)=O |
Physicochemical Information | |
Melting Point | 100-101°C |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | soluble in chloroform and ethanol<<0262>><<0342>><<0371>><<0403>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |