LBF16401SC01
From Metabolomics.JP
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA0204 |
LipidMaps | LMFA01030165 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF16401SC01.mol |
![]() | |
Structural Information | |
Systematic Name | 4, 8, 12, 16-Hexadesatetraenoic acid |
Common Name | |
Symbol | |
Formula | C16H24O2 |
Exact Mass | 248.17763001199998 |
Average Mass | 248.36056 |
SMILES | C=CCC=CCCC=CCCC=CCCC(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | soluble in acetone, alcohol, ether and petroleum ether.<<0268>><<0295>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |