LBF18206SC04
From Metabolomics.JP
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA0152 |
| LipidMaps | LMFA01030113 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF18206SC04.mol |
| |
| Structural Information | |
| Systematic Name | trans-5, trans-12-Octadecadienoic acid |
| Common Name | |
| Symbol | |
| Formula | C18H32O2 |
| Exact Mass | 280.240230268 |
| Average Mass | 280.44548000000003 |
| SMILES | CCCCCC=CCCCCCC=CCCCC(O)=O |
| Physicochemical Information | |
| Melting Point | 16°C to 19°C |
| Boiling Point | 175°C to 176°C at 0.4mmHg |
| Density | |
| Optical Rotation | 1.4671 at 20°C |
| Reflactive Index | |
| Solubility | <<0018>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
