LBF18304HP04
From Metabolomics.JP
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA8065 |
LipidMaps | LMFA01040049 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18304HP04.mol |
![]() | |
Structural Information | |
Systematic Name | Methyl-10,16-Dihydroperoxy-8,12,14-Octadecatrienoate |
Common Name | |
Symbol | |
Formula | C19H32O6 |
Exact Mass | 356.219888756 |
Average Mass | 356.45378 |
SMILES | COC(=O)CCCCCCC=CC(OO)CC=CC=CC(CC)OO |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | GC-EI-MS(after reduction and TMS-derivatization)<<8084>>: m/e=468[M]; 439[M-CH2CH3]; 437[M-OCH3]; 378[M-HOTMS]; 349[439-HOTMS]; 271[SMTO=CHCH=CH(CH2)6COOCH3]; 197[M-271]; CI-MS(110): m/e=339[M+H-H20]; 323[M-OOH]; 305[323-H2O]; 199[CHOCH=CH(CH2)6COOCH3+H] |
UV Spectra | Conjugated diene: lmax=232nm<<8084>> |
IR Spectra | OOH group: 3700-3140cm-1[bonded], 3520-3510cm-1[free]; conjugated cis,trans diene: 985-979cm-1, 953-935cm-1; isolated trans unsaturation: 968-960cm-1<<8084>> |
NMR Spectra | 1H-NMR<<8084>>: C2: 2.31ppm; C7, 11, 17: 2.08ppm; C8, 9, 12, 13, 15: 5.25-6.25ppm; C10, 16: 4.34ppm; C14: 6.55ppm; C18: 0.93ppm; OOH: 8.04ppm<<8084>> |
Chromatograms |