LBF18304SC01
From Metabolomics.JP
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA0181 |
LipidMaps | LMFA01030142 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18304SC01.mol |
![]() | |
Structural Information | |
Systematic Name | 6, 10, 14-Octadecatrienoic acid |
Common Name | |
Symbol | |
Formula | C18H30O2 |
Exact Mass | 278.224580204 |
Average Mass | 278.4296 |
SMILES | CCCC=CCCC=CCCC=CCCCCC(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | dX420 0.9221 |
Optical Rotation | 1.4794 at 20°C |
Reflactive Index | |
Solubility | soluble in ethanol, pentane and petroleum ether.<<0495>><<0498>><<0499>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |