LBF18306SC03
From Metabolomics.JP
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA0182 |
LipidMaps | LMFA01030143 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18306SC03.mol |
![]() | |
Structural Information | |
Systematic Name | cis-8, trans-10, cis-12-Octadecatrienoic acid |
Common Name | |
Symbol | |
Formula | C18H30O2 |
Exact Mass | 278.224580204 |
Average Mass | 278.4296 |
SMILES | CCCCCC=CC=CC=CCCCCCCC(O)=O |
Physicochemical Information | |
Melting Point | 43.5-44°C |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | very soluble in petroleumether and soluble in acetone, ethanol, CS2 and pentane.<<0125>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |