LBF20406HO03
From Metabolomics.JP
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA8085 |
LipidMaps | LMFA03060040 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406HO03.mol |
![]() | |
Structural Information | |
Systematic Name | 6-Hydroperoxy-4,8,11,14-Eicosatetraenoic Acid/6-Hydroperoxy-4,8,11,14-Eicosatetraenoate |
Common Name | |
Symbol | |
Formula | C20H32O4 |
Exact Mass | 336.23005951199997 |
Average Mass | 336.46567999999996 |
SMILES | C(CC=CCC=CCC=CCC(OO)C=CCCC(O)=O)CCC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | GC-EI-MS(Me-ester; after reduction and TMS)<<8098>>: m/e=406[M]; 316[M-HOTMS]; GC-EI-MS(Me-ester; after reduction and TBDMS)<<8098>>: m/e=448[M], 391[M-(CH3)3C], GC-EI-MS(Me-ester; after reduction, hydrogenation and TMS)<<8098/8099>>: m/e=399[M-CH3] |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |