LBF22206SC01
From Metabolomics.JP
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA0171 |
| LipidMaps | LMFA01030132 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF22206SC01.mol |
| |
| Structural Information | |
| Systematic Name | 13, 16-Docosadienoic acid |
| Common Name | |
| Symbol | |
| Formula | C22H40O2 |
| Exact Mass | 336.302830524 |
| Average Mass | 336.5518 |
| SMILES | C(CCC(O)=O)CCCCCCCCC=CCC=CCCCCC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | soluble in acetone and ether.<<0045>><<0241>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
