LBF22503SC02
From Metabolomics.JP
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA0223 |
| LipidMaps | LMFA01030184 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF22503SC02.mol |
| |
| Structural Information | |
| Systematic Name | 7, 10, 13, 16, 19-Docosapentaenoic acid |
| Common Name | |
| Symbol | |
| Formula | C22H34O2 |
| Exact Mass | 330.255880332 |
| Average Mass | 330.50416000000007 |
| SMILES | C(CCC(O)=O)CCC=CCC=CCC=CCC=CCC=CCC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | soluble in benzene, chloroform, ether, methyl alcohol and petroleum ether.<<0005>><<0006>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | Gas liquid chromatogram  (provided by Dr. Akiko Horiuchi). |
