FL3FAINS0001
From Metabolomics.JP
(Difference between revisions)
| (7 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName= | + | |SysName=5,7-Dihydroxy-2- (4-hydroxy-3,5-dimethoxyphenyl) -4H-1-benzopyran-4-one |
| − | |Common Name=&&Tricin&&5,7,4'-Trihydroxy-3',5'-dimethoxyflavone&& | + | |Common Name=&&Tricin&&5,7,4'-Trihydroxy-3',5'-dimethoxyflavone&&3',5'-O-Dimethyltricetin&& |
|CAS=520-32-1 | |CAS=520-32-1 | ||
|KNApSAcK=C00013329 | |KNApSAcK=C00013329 | ||
}} | }} | ||
Latest revision as of 17:12, 5 September 2012
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FAI Tricin (21 pages) : FL3FAINS Simple substitution (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 520-32-1 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FAINS0001.mol |
| Tricin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7-Dihydroxy-2- (4-hydroxy-3,5-dimethoxyphenyl) -4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C17H14O7 |
| Exact Mass | 330.073952802 |
| Average Mass | 330.28886 |
| SMILES | COc(c1)c(O)c(OC)cc1C(=C2)Oc(c3)c(c(O)cc(O)3)C(=O)2 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
