FL5FECGS0010
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |SysName=7-[(beta-D-Glucopyranosyl)oxy]-3,3',4',5-tetrahydroxy-6-methoxyflavone |
|Common Name=&&Patuletin 7-glucoside&& | |Common Name=&&Patuletin 7-glucoside&& | ||
|CAS=19833-25-1 | |CAS=19833-25-1 | ||
|KNApSAcK=C00005644 | |KNApSAcK=C00005644 | ||
}} | }} |
Revision as of 09:00, 13 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 19833-25-1 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL5FECGS0010.mol |
Patuletin 7-glucoside | |
---|---|
Structural Information | |
Systematic Name | 7-[(beta-D-Glucopyranosyl)oxy]-3,3',4',5-tetrahydroxy-6-methoxyflavone |
Common Name |
|
Symbol | |
Formula | C22H22O13 |
Exact Mass | 494.10604078999995 |
Average Mass | 494.40228 |
SMILES | COc(c1O[C@@H]([C@@H](O)4)OC(CO)[C@@H]([C@@H]4O)O)c |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |