FL1C1ANI0031
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1C Chalcone : FL1C1A Isoliquiritigenin and O-methyl derivatives (81 pages) : FL1C1ANI Non-cyclic prenyl substituted (33 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 202815-28-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1C1ANI0031.mol |
| Licoagrochalcone A | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3-Prenyl-4,2',4'-trihydroxychalcone |
| Common Name |
|
| Symbol | |
| Formula | C20H20O4 |
| Exact Mass | 324.136159128 |
| Average Mass | 324.37039999999996 |
| SMILES | c(c1C=CC(=O)c(c(O)2)ccc(O)c2)c(c(O)cc1)CC=C(C)C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
