FL1C1LNI0001
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1C Chalcone : FL1C1L 2,(3),4,(5),(6),2',4'-Hydroxychalcone and O-methyl derivatives (9 pages) : FL1C1LNI Non-cyclic prenyl substituted (6 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 76472-88-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1C1LNI0001.mol |
| Morachalcone A | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (E) -1- [ 2,4-Dihydroxy-3- (3-methyl-2-butenyl) phenyl ] -3- (2,4-dihydroxyphenyl) -2-propene-1-one |
| Common Name |
|
| Symbol | |
| Formula | C20H20O5 |
| Exact Mass | 340.13107375 |
| Average Mass | 340.3698 |
| SMILES | Oc(c2)cc(O)c(c2)C=CC(=O)c(c1)c(O)c(c(O)c1)CC=C(C)C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
