FL1C28NI0001
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1C Chalcone : FL1C28 2,(3),(5),(6),2',4',5'-Hydroxychalcone and O-methyl derivatives (4 pages) : FL1C28NI Non-cyclic prenyl substituted (1 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 25146-22-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1C28NI0001.mol |
| 5-Deoxyhomoflemingin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (E) -1- [ 3- [ (E) -3,7-Dimethyl-2,6-octadienyl ] -2,4-dihydroxy-5-methoxyphenyl ] -3- (2-hydroxyphenyl) -2-propen-1-one |
| Common Name |
|
| Symbol | |
| Formula | C26H30O5 |
| Exact Mass | 422.20932407 |
| Average Mass | 422.5134 |
| SMILES | c(c1C=CC(=O)c(c(O)2)cc(c(c2CC=C(CCC=C(C)C)C)O)OC)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
