FL1CA9NI0001
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1C Chalcone : FL1CA9 (3),(5),2',4',6'-Hydroxychalcone (39 pages) : FL1CA9NI Non-cyclic prenyl substituted (7 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 72247-78-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1CA9NI0001.mol |
| Desmethylisoxanthohumol | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2',4',6'-Trihydroxy-3'-prenylchalcone |
| Common Name |
|
| Symbol | |
| Formula | C20H20O4 |
| Exact Mass | 324.136159128 |
| Average Mass | 324.37039999999996 |
| SMILES | C(c(c1O)c(cc(c1C(=O)C=Cc(c2)cccc2)O)O)C=C(C)C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
