FL1CA9NM0005
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1C Chalcone : FL1CA9 (3),(5),2',4',6'-Hydroxychalcone (39 pages) : FL1CA9NM C-Methyl or C2/C3 substituted (5 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 65349-31-7 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1CA9NM0005.mol |
| 2',4'-Dihydroxy-6'-methoxy-3',5'-dimethylchalcone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2',4'-Dihydroxy-6'-methoxy-3',5'-dimethylchalcone |
| Common Name |
|
| Symbol | |
| Formula | C18H18O4 |
| Exact Mass | 298.120509064 |
| Average Mass | 298.33312 |
| SMILES | c(c2C)(c(c(c(c2O)C(=O)C=Cc(c1)cccc1)OC)C)O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
