FL1CA9NN0001
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1C Chalcone : FL1CA9 (3),(5),2',4',6'-Hydroxychalcone (39 pages) : FL1CA9NN Flavonophenylpropanoid (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 73536-03-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1CA9NN0001.mol |
| 8-Cinnamoyl-3,4-dihydro-5,7-dihydroxy-4-phenylcoumarin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 8-Cinnamoyl-3,4-dihydro-5,7-dihydroxy-4-phenylcoumarin |
| Common Name |
|
| Symbol | |
| Formula | C24H18O5 |
| Exact Mass | 386.115423686 |
| Average Mass | 386.39672 |
| SMILES | C(C(c(c32)c(cc(c(C(c(c4)cccc4)CC(=O)O3)2)O)O)=O)=C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
