FL1CCBNSH001
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1C Chalcone : FL1CCB Gymnogrammene (2 pages) : FL1CCBNS Simple substitution (1 pages) : FL1CCBNSH Halogen incluted (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 860000-36-8 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1CCBNSH001.mol |
| 3'-Bromo-6'-hydroxy-2',4,4'-trimethoxychalcone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3'-Bromo-6'-hydroxy-2',4,4'-trimethoxychalcone |
| Common Name |
|
| Symbol | |
| Formula | C18H17BrO5 |
| Exact Mass | 392.025936254 |
| Average Mass | 393.22857999999997 |
| SMILES | c(c1O)c(c(c(c(C(=O)C=Cc(c2)ccc(OC)c2)1)OC)Br)OC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
