FL1CRTNI0002
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1C Chalcone : FL1CRT Retrochalcone (14 pages) : FL1CRTNI Non-cyclic prenyl substituted (3 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 58749-22-7 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1CRTNI0002.mol |
| Licochalcone A | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (E) -3- [ 5- (1,1-Dimethyl-2-propenyl) -4-hydroxy-2-methoxyphenyl ] -1- (4-hydroxyphenyl) -2-propen-1-one |
| Common Name |
|
| Symbol | |
| Formula | C21H22O4 |
| Exact Mass | 338.151809192 |
| Average Mass | 338.39698 |
| SMILES | C(c(c1)c(cc(OC)c(C=CC(=O)c(c2)ccc(O)c2)1)O)(C)(C)C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
