FL1CRTNS0003
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1C Chalcone : FL1CRT Retrochalcone (14 pages) : FL1CRTNS Simple substitution (5 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 145039-50-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1CRTNS0003.mol |
| Tepanone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (E) -1-Phenyl-3- (2-hydroxy-3,4,6-trimethoxyphenyl) -2-propen-1-one |
| Common Name |
|
| Symbol | |
| Formula | C18H18O5 |
| Exact Mass | 314.115423686 |
| Average Mass | 314.33252 |
| SMILES | c(c2OC)(OC)cc(c(c2O)C=CC(=O)c(c1)cccc1)OC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
