FL2FALNI0023
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL2 Flavanone : FL2FAL 5,7,2',(3'),4',(5'),(6')-Hydroxyflavanone and O-methyl derivatives (78 pages) : FL2FALNI Non-cyclic prenyl substituted (40 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 149725-18-8 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2FALNI0023.mol |
| Exiguaflavanone E | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,2',4'-Trihydroxy-7,5'-dimethoxy-8-C-lavandulylflavanone |
| Common Name |
|
| Symbol | |
| Formula | C27H32O7 |
| Exact Mass | 468.214803378 |
| Average Mass | 468.53878 |
| SMILES | C(C3=O)C(Oc(c32)c(CC(C(C)=C)CC=C(C)C)c(cc(O)2)OC)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
