FL3FEANSS001
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FEA Scutellarein and O-methyl derivatives (71 pages) : FL3FEANS Simple substitution (14 pages) : FL3FEANSS Sulfate incluted (2 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 110209-96-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FEANSS001.mol |
| Hispidulin 7-sulfate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7,4'-Trihydroxy-6-methoxyflavone 7-sulfate |
| Common Name |
|
| Symbol | |
| Formula | C16H12O9S |
| Exact Mass | 380.020202672 |
| Average Mass | 380.32708 |
| SMILES | COc(c(O)1)c(cc(O2)c(C(=O)C=C2c(c3)ccc(O)c3)1)OS(O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
