FL5FAAGL0015
From Metabolomics.JP
				
								
				
				
																
				
				
								
				
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input | 
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FAA Kaempferol (349 pages) : FL5FAAGL 3-Glucoside and related (112 pages) : FL5FAAGL0 Normal (109 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 25615-14-9 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FAAGL0015.mol | 
| Kaempferol 3,7-diglucoside | |
|---|---|
  
 | |
| Structural Information | |
| Systematic Name | 3,7-Bis [ (beta-D-glucopyranosyl) oxy ] -4',5-dihydroxyflavone | 
| Common Name | 
  | 
| Symbol | |
| Formula | C27H30O16 | 
| Exact Mass | 610.153384912 | 
| Average Mass | 610.5175 | 
| SMILES |  O([C@@H]([C@@H](O)5)OC(CO)[C@H](O)[C@@H]5O)c(c4)cc | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
